C19H30BrClIN3O2 — CID 111644319
2-[(4-bromo-2-chlorophenyl)methyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111644319) has the molecular formula C19H30BrClIN3O2 and a molecular weight of 574.73 g/mol. Its IUPAC name is 2-[(4-bromo-2-chlorophenyl)methyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[(4-bromo-2-chlorophenyl)methyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111644319 |
| Molecular Formula | C19H30BrClIN3O2 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | 2-[(4-bromo-2-chlorophenyl)methyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Br)cc1Cl)NCCCOCC1CCOCC1.I |
| InChI | InChI=1S/C19H29BrClN3O2.HI/c1-2-22-19(24-13-16-4-5-17(20)12-18(16)21)23-8-3-9-26-14-15-6-10-25-11-7-15;/h4-5,12,15H,2-3,6-11,13-14H2,1H3,(H2,22,23,24);1H |
| InChIKey | NRPYTCGRWXBKAJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|