C17H28N4O4 — CID 111645592
N-(furan-2-ylmethyl)-2-[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]acetamide (PubChem CID 111645592) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111645592 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCCCOCC1CCOC1)NCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H28N4O4/c1-18-17(19-6-3-7-23-12-14-5-9-24-13-14)21-11-16(22)20-10-15-4-2-8-25-15/h2,4,8,14H,3,5-7,9-13H2,1H3,(H,20,22)(H2,18,19,21) |
| InChIKey | NYSHDJBPAFZUQF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|