C15H30IN3O4 — CID 111645665
methyl 2-methyl-3-[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111645665) has the molecular formula C15H30IN3O4 and a molecular weight of 443.33 g/mol. Its IUPAC name is methyl 2-methyl-3-[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 2-methyl-3-[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111645665 |
| Molecular Formula | C15H30IN3O4 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | methyl 2-methyl-3-[[N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(/NCCCOCC1CCOC1)NCC(C)C(=O)OC.I |
| InChI | InChI=1S/C15H29N3O4.HI/c1-12(14(19)20-3)9-18-15(16-2)17-6-4-7-21-10-13-5-8-22-11-13;/h12-13H,4-11H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | BKNLJRGHQZYKGP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|