C19H34O5Si — CID 11164589
dimethyl 2-[(2E)-4-tri(propan-2-yl)silyloxypenta-2,4-dienyl]propanedioate (PubChem CID 11164589) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is dimethyl 2-[(2E)-4-tri(propan-2-yl)silyloxypenta-2,4-dienyl]propanedioate.
| Compound Name | dimethyl 2-[(2E)-4-tri(propan-2-yl)silyloxypenta-2,4-dienyl]propanedioate |
|---|---|
| PubChem CID | 11164589 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | dimethyl 2-[(2E)-4-tri(propan-2-yl)silyloxypenta-2,4-dienyl]propanedioate |
| SMILES | C=C(/C=C/CC(C(=O)OC)C(=O)OC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H34O5Si/c1-13(2)25(14(3)4,15(5)6)24-16(7)11-10-12-17(18(20)22-8)19(21)23-9/h10-11,13-15,17H,7,12H2,1-6,8-9H3/b11-10+ |
| InChIKey | VCRYWFJLPXHLRT-ZHACJKMWSA-N |
| XLogP | 4.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|