C25H24O3 — CID 11164647
(1'S,3E,5'R,7'R)-3-benzylidene-5'-methylspiro[1,2-dihydronaphthalene-4,8'-9,10-dioxatricyclo[5.2.1.01,5]decane]-6'-one (PubChem CID 11164647) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is (1'S,3E,5'R,7'R)-3-benzylidene-5'-methylspiro[1,2-dihydronaphthalene-4,8'-9,10-dioxatricyclo[5.2.1.01,5]decane]-6'-one.
| Compound Name | (1'S,3E,5'R,7'R)-3-benzylidene-5'-methylspiro[1,2-dihydronaphthalene-4,8'-9,10-dioxatricyclo[5.2.1.01,5]decane]-6'-one |
|---|---|
| PubChem CID | 11164647 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (1'S,3E,5'R,7'R)-3-benzylidene-5'-methylspiro[1,2-dihydronaphthalene-4,8'-9,10-dioxatricyclo[5.2.1.01,5]decane]-6'-one |
| SMILES | C[C@]12CCC[C@@]13O[C@@H](C2=O)C1(O3)/C(=C/c2ccccc2)CCc2ccccc21 |
| InChI | InChI=1S/C25H24O3/c1-23-14-7-15-24(23)27-22(21(23)26)25(28-24)19(16-17-8-3-2-4-9-17)13-12-18-10-5-6-11-20(18)25/h2-6,8-11,16,22H,7,12-15H2,1H3/b19-16+/t22-,23+,24-,25?/m0/s1 |
| InChIKey | RINQQERVXNJMHK-PXKBMZPTSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |