C16H26BrN3O2S — CID 111646780
2-[(4-bromothiophen-2-yl)methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine (PubChem CID 111646780) has the molecular formula C16H26BrN3O2S and a molecular weight of 404.37 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111646780 |
| Molecular Formula | C16H26BrN3O2S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(Br)cs1)NCCCOCC1CCOC1 |
| InChI | InChI=1S/C16H26BrN3O2S/c1-2-18-16(20-9-15-8-14(17)12-23-15)19-5-3-6-21-10-13-4-7-22-11-13/h8,12-13H,2-7,9-11H2,1H3,(H2,18,19,20) |
| InChIKey | GEZMIHJCUCALTN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|