C21H33ClIN3O2 — CID 111646781
2-[[1-(4-chlorophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111646781) has the molecular formula C21H33ClIN3O2 and a molecular weight of 521.87 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-(4-chlorophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111646781 |
| Molecular Formula | C21H33ClIN3O2 |
| Molecular Weight | 521.87 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)cyclopropyl]methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccc(Cl)cc2)CC1)NCCCOCC1CCOC1.I |
| InChI | InChI=1S/C21H32ClN3O2.HI/c1-2-23-20(24-11-3-12-26-14-17-8-13-27-15-17)25-16-21(9-10-21)18-4-6-19(22)7-5-18;/h4-7,17H,2-3,8-16H2,1H3,(H2,23,24,25);1H |
| InChIKey | OCKINXFXEYGVTK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|