C19H31ClIN3O2 — CID 111647687
1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111647687) has the molecular formula C19H31ClIN3O2 and a molecular weight of 495.83 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111647687 |
| Molecular Formula | C19H31ClIN3O2 |
| Molecular Weight | 495.83 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CCOC1)NCCc1cccc(Cl)c1.I |
| InChI | InChI=1S/C19H30ClN3O2.HI/c1-2-21-19(23-10-7-16-5-3-6-18(20)13-16)22-9-4-11-24-14-17-8-12-25-15-17;/h3,5-6,13,17H,2,4,7-12,14-15H2,1H3,(H2,21,22,23);1H |
| InChIKey | KMHLIIXZJFPCQZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|