C14H19IO4 — CID 11164816
methyl (6E,8Z)-9-iodo-2,4,6,8-tetramethyl-3,5-dioxonona-6,8-dienoate (PubChem CID 11164816) has the molecular formula C14H19IO4 and a molecular weight of 378.21 g/mol. Its IUPAC name is methyl (6E,8Z)-9-iodo-2,4,6,8-tetramethyl-3,5-dioxonona-6,8-dienoate.
| Compound Name | methyl (6E,8Z)-9-iodo-2,4,6,8-tetramethyl-3,5-dioxonona-6,8-dienoate |
|---|---|
| PubChem CID | 11164816 |
| Molecular Formula | C14H19IO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | methyl (6E,8Z)-9-iodo-2,4,6,8-tetramethyl-3,5-dioxonona-6,8-dienoate |
| SMILES | COC(=O)C(C)C(=O)C(C)C(=O)/C(C)=C/C(C)=C\I |
| InChI | InChI=1S/C14H19IO4/c1-8(7-15)6-9(2)12(16)10(3)13(17)11(4)14(18)19-5/h6-7,10-11H,1-5H3/b8-7-,9-6+ |
| InChIKey | UAXYPSBZGBJLIT-SOKJVCRVSA-N |
| XLogP | 2.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|