C18H30N4O — CID 111648720
2-[[[2-(3,5-dimethylphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-propylacetamide (PubChem CID 111648720) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is 2-[[[2-(3,5-dimethylphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-propylacetamide.
| Compound Name | 2-[[[2-(3,5-dimethylphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 111648720 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 2-[[[2-(3,5-dimethylphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)C/N=C(\NCC)NCCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H30N4O/c1-5-8-20-17(23)13-22-18(19-6-2)21-9-7-16-11-14(3)10-15(4)12-16/h10-12H,5-9,13H2,1-4H3,(H,20,23)(H2,19,21,22) |
| InChIKey | WVPFTZMECLDMPU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|