C13H8Br2N4 — CID 11164880
3,5-bis(bromomethyl)-[1,2,4]triazolo[3,4-a]isoquinoline-6-carbonitrile (PubChem CID 11164880) has the molecular formula C13H8Br2N4 and a molecular weight of 380.04 g/mol. Its IUPAC name is 3,5-bis(bromomethyl)-[1,2,4]triazolo[3,4-a]isoquinoline-6-carbonitrile.
| Compound Name | 3,5-bis(bromomethyl)-[1,2,4]triazolo[3,4-a]isoquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 11164880 |
| Molecular Formula | C13H8Br2N4 |
| Molecular Weight | 380.04 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | 3,5-bis(bromomethyl)-[1,2,4]triazolo[3,4-a]isoquinoline-6-carbonitrile |
| SMILES | N#Cc1c(CBr)n2c(CBr)nnc2c2ccccc12 |
| InChI | InChI=1S/C13H8Br2N4/c14-5-11-10(7-16)8-3-1-2-4-9(8)13-18-17-12(6-15)19(11)13/h1-4H,5-6H2 |
| InChIKey | KUWOOYDAHMKAGJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.04 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|