C18H27N5 — CID 111649132
2-[2-(3,5-dimethylphenyl)ethyl]-1-ethyl-3-(2-pyrazol-1-ylethyl)guanidine (PubChem CID 111649132) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylphenyl)ethyl]-1-ethyl-3-(2-pyrazol-1-ylethyl)guanidine.
| Compound Name | 2-[2-(3,5-dimethylphenyl)ethyl]-1-ethyl-3-(2-pyrazol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111649132 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 2-[2-(3,5-dimethylphenyl)ethyl]-1-ethyl-3-(2-pyrazol-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCc1cc(C)cc(C)c1)NCCn1cccn1 |
| InChI | InChI=1S/C18H27N5/c1-4-19-18(21-9-11-23-10-5-7-22-23)20-8-6-17-13-15(2)12-16(3)14-17/h5,7,10,12-14H,4,6,8-9,11H2,1-3H3,(H2,19,20,21) |
| InChIKey | UGBHBBCIPUSYBL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|