C17H26BrN3O — CID 111649864
1-[[1-(2-bromophenyl)cyclopropyl]methyl]-3-(3-ethoxypropyl)-2-methylguanidine (PubChem CID 111649864) has the molecular formula C17H26BrN3O and a molecular weight of 368.32 g/mol. Its IUPAC name is 1-[[1-(2-bromophenyl)cyclopropyl]methyl]-3-(3-ethoxypropyl)-2-methylguanidine.
| Compound Name | 1-[[1-(2-bromophenyl)cyclopropyl]methyl]-3-(3-ethoxypropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111649864 |
| Molecular Formula | C17H26BrN3O |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-[[1-(2-bromophenyl)cyclopropyl]methyl]-3-(3-ethoxypropyl)-2-methylguanidine |
| SMILES | CCOCCCN/C(=N\C)NCC1(c2ccccc2Br)CC1 |
| InChI | InChI=1S/C17H26BrN3O/c1-3-22-12-6-11-20-16(19-2)21-13-17(9-10-17)14-7-4-5-8-15(14)18/h4-5,7-8H,3,6,9-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | BNGCFINIXSZEHA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|