C21H35IN6O — CID 111650323
1-[2-(1-benzylimidazol-2-yl)ethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111650323) has the molecular formula C21H35IN6O and a molecular weight of 514.46 g/mol. Its IUPAC name is 1-[2-(1-benzylimidazol-2-yl)ethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1-benzylimidazol-2-yl)ethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111650323 |
| Molecular Formula | C21H35IN6O |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 1-[2-(1-benzylimidazol-2-yl)ethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1nccn1Cc1ccccc1)NCCN(C)CCCOC.I |
| InChI | InChI=1S/C21H34N6O.HI/c1-22-21(25-12-15-26(2)14-7-17-28-3)24-11-10-20-23-13-16-27(20)18-19-8-5-4-6-9-19;/h4-6,8-9,13,16H,7,10-12,14-15,17-18H2,1-3H3,(H2,22,24,25);1H |
| InChIKey | SINBQPGXTDKQNM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|