C19H33IN4O3 — CID 111650977
ethyl 4-[[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzoate;hydroiodide (PubChem CID 111650977) has the molecular formula C19H33IN4O3 and a molecular weight of 492.40 g/mol. Its IUPAC name is ethyl 4-[[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzoate;hydroiodide.
| Compound Name | ethyl 4-[[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111650977 |
| Molecular Formula | C19H33IN4O3 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | ethyl 4-[[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzoate;hydroiodide |
| SMILES | CCOC(=O)c1ccc(CN/C(=N/C)NCCN(C)CCCOC)cc1.I |
| InChI | InChI=1S/C19H32N4O3.HI/c1-5-26-18(24)17-9-7-16(8-10-17)15-22-19(20-2)21-11-13-23(3)12-6-14-25-4;/h7-10H,5-6,11-15H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | RANWTJHYOBQAGG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|