C14H29IN6O2 — CID 111651473
1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111651473) has the molecular formula C14H29IN6O2 and a molecular weight of 440.33 g/mol. Its IUPAC name is 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111651473 |
| Molecular Formula | C14H29IN6O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)no1)NCCN(C)CCCOC.I |
| InChI | InChI=1S/C14H28N6O2.HI/c1-5-15-14(17-11-13-18-12(2)19-22-13)16-7-9-20(3)8-6-10-21-4;/h5-11H2,1-4H3,(H2,15,16,17);1H |
| InChIKey | HHCISBWMAPVLQC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|