C18H30IN3O3 — CID 111651671
1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)-2-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111651671) has the molecular formula C18H30IN3O3 and a molecular weight of 463.36 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)-2-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)-2-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111651671 |
| Molecular Formula | C18H30IN3O3 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)-2-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | I.c1coc(CCN/C(=N\CC2CCCO2)NCC2CCCCO2)c1 |
| InChI | InChI=1S/C18H29N3O3.HI/c1-2-10-23-16(5-1)13-20-18(21-14-17-7-4-12-24-17)19-9-8-15-6-3-11-22-15;/h3,6,11,16-17H,1-2,4-5,7-10,12-14H2,(H2,19,20,21);1H |
| InChIKey | IYQGWQNMOPWKHE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|