About 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole
2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole (PubChem CID 1116520) has the molecular formula C24H20N2O4
and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole |
| PubChem CID | 1116520 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole |
| SMILES | COc1ccc(-c2nc(-c3ccc4c(c3)OCO4)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H20N2O4/c1-27-18-8-3-15(4-9-18)22-23(16-5-10-19(28-2)11-6-16)26-24(25-22)17-7-12-20-21(13-17)30-14-29-20/h3-13H,14H2,1-2H3,(H,25,26) |
| InChIKey | YOZXNYCRIMHVKQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole (CID 1116520) is 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole is COc1ccc(-c2nc(-c3ccc4c(c3)OCO4)[nH]c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole?
The InChIKey is YOZXNYCRIMHVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O4/c1-27-18-8-3-15(4-9-18)22-23(16-5-10-19(28-2)11-6-16)26-24(25-22)17-7-12-20-21(13-17)30-14-29-20/h3-13H,14H2,1-2H3,(H,25,26).
What are the key properties of 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole?
2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole has a molecular weight of 400.43 g/mol, XLogP of 5.16, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-4,5-bis(4-methoxyphenyl)-1H-imidazole is sourced from PubChem (CID 1116520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).