C23H34O5 — CID 11165218
methyl (1R,2R,4S,5R,9S,10S,12S,13R)-12-acetyloxy-2-hydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylate (PubChem CID 11165218) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is methyl (1R,2R,4S,5R,9S,10S,12S,13R)-12-acetyloxy-2-hydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylate.
| Compound Name | methyl (1R,2R,4S,5R,9S,10S,12S,13R)-12-acetyloxy-2-hydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylate |
|---|---|
| PubChem CID | 11165218 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | methyl (1R,2R,4S,5R,9S,10S,12S,13R)-12-acetyloxy-2-hydroxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3C[C@H](OC(C)=O)[C@@H]4C[C@]3(C=C4C)[C@H](O)C[C@@H]21 |
| InChI | InChI=1S/C23H34O5/c1-13-11-23-12-15(13)16(28-14(2)24)9-18(23)21(3)7-6-8-22(4,20(26)27-5)17(21)10-19(23)25/h11,15-19,25H,6-10,12H2,1-5H3/t15-,16+,17+,18+,19-,21-,22-,23+/m1/s1 |
| InChIKey | FFEDTPXWBKQTGX-BPEWGCAGSA-N |
| XLogP | 3.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|