C15H28I2N4OS — CID 111652261
1-[2-(5-iodothiophen-2-yl)ethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111652261) has the molecular formula C15H28I2N4OS and a molecular weight of 566.29 g/mol. Its IUPAC name is 1-[2-(5-iodothiophen-2-yl)ethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-iodothiophen-2-yl)ethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111652261 |
| Molecular Formula | C15H28I2N4OS |
| Molecular Weight | 566.29 g/mol |
| Exact Mass | 566.01 |
| IUPAC Name | 1-[2-(5-iodothiophen-2-yl)ethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(I)s1)NCCN(C)CCCOC.I |
| InChI | InChI=1S/C15H27IN4OS.HI/c1-17-15(18-8-7-13-5-6-14(16)22-13)19-9-11-20(2)10-4-12-21-3;/h5-6H,4,7-12H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | VUZJQAYQQZCQQF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|