About 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile
4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile (PubChem CID 11165313) has the molecular formula C23H20ClNOS
and a molecular weight of 393.94 g/mol. Its IUPAC name is 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile.
Molecular Properties
| Compound Name | 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile |
| PubChem CID | 11165313 |
| Molecular Formula | C23H20ClNOS |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile |
| SMILES | Cc1ccc(S(=O)C(Cl)C(CC#N)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20ClNOS/c1-18-12-14-21(15-13-18)27(26)22(24)23(16-17-25,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,22H,16H2,1H3 |
| InChIKey | OAMSKAACXALFGR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile?
The IUPAC name of 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile (CID 11165313) is 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile.
What is the SMILES notation for 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile?
The canonical SMILES for 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile is Cc1ccc(S(=O)C(Cl)C(CC#N)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile?
The InChIKey is OAMSKAACXALFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20ClNOS/c1-18-12-14-21(15-13-18)27(26)22(24)23(16-17-25,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,22H,16H2,1H3.
What are the key properties of 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile?
4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile has a molecular weight of 393.94 g/mol, XLogP of 5.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-4-(4-methylphenyl)sulfinyl-3,3-diphenylbutanenitrile is sourced from PubChem (CID 11165313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).