C20H38N6O — CID 111653344
2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine (PubChem CID 111653344) has the molecular formula C20H38N6O and a molecular weight of 378.57 g/mol. Its IUPAC name is 2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine.
| Compound Name | 2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111653344 |
| Molecular Formula | C20H38N6O |
| Molecular Weight | 378.57 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 2-[[6-(diethylamino)-3-pyridinyl]methyl]-1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N(CC)CC)nc1)NCCN(C)CCCOC |
| InChI | InChI=1S/C20H38N6O/c1-6-21-20(22-12-14-25(4)13-9-15-27-5)24-17-18-10-11-19(23-16-18)26(7-2)8-3/h10-11,16H,6-9,12-15,17H2,1-5H3,(H2,21,22,24) |
| InChIKey | QMOGXWIGDLZSRM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.57 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|