C17H39N5O — CID 111653392
1-[2-(dimethylamino)-4-methylpentyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine (PubChem CID 111653392) has the molecular formula C17H39N5O and a molecular weight of 329.53 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-4-methylpentyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(dimethylamino)-4-methylpentyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111653392 |
| Molecular Formula | C17H39N5O |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.32 |
| IUPAC Name | 1-[2-(dimethylamino)-4-methylpentyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN(C)CCCOC)NCC(CC(C)C)N(C)C |
| InChI | InChI=1S/C17H39N5O/c1-15(2)13-16(21(4)5)14-20-17(18-3)19-9-11-22(6)10-8-12-23-7/h15-16H,8-14H2,1-7H3,(H2,18,19,20) |
| InChIKey | OJOUUCBJECZDFM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|