C17H25N3O6S — CID 11165472
[(3S)-3-(ethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-7-yl]sulfamic acid (PubChem CID 11165472) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is [(3S)-3-(ethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-7-yl]sulfamic acid.
| Compound Name | [(3S)-3-(ethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-7-yl]sulfamic acid |
|---|---|
| PubChem CID | 11165472 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [(3S)-3-(ethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-7-yl]sulfamic acid |
| SMILES | CCNC(=O)[C@@H]1Cc2ccc(NS(=O)(=O)O)cc2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25N3O6S/c1-5-18-15(21)14-9-11-6-7-13(19-27(23,24)25)8-12(11)10-20(14)16(22)26-17(2,3)4/h6-8,14,19H,5,9-10H2,1-4H3,(H,18,21)(H,23,24,25)/t14-/m0/s1 |
| InChIKey | KRXWAZZPABWYAN-AWEZNQCLSA-N |
| XLogP | 1.70 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|