C15H7Cl2F5OS — CID 11165519
1-[(E)-2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 11165519) has the molecular formula C15H7Cl2F5OS and a molecular weight of 401.18 g/mol. Its IUPAC name is 1-[(E)-2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[(E)-2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 11165519 |
| Molecular Formula | C15H7Cl2F5OS |
| Molecular Weight | 401.18 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | 1-[(E)-2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | O=S(/C=C/c1c(F)c(F)c(F)c(F)c1F)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H7Cl2F5OS/c16-9-2-1-7(5-10(9)17)6-24(23)4-3-8-11(18)13(20)15(22)14(21)12(8)19/h1-5H,6H2/b4-3+ |
| InChIKey | WZDHZLZRVPWNKR-ONEGZZNKSA-N |
| XLogP | 5.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.18 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|