C15H13BrFNO4S — CID 11165538
7-(3-bromo-4-fluorophenyl)-5-methyl-1,1-dioxo-2,3,4,7-tetrahydrothieno[3,2-b]pyridine-6-carboxylic acid (PubChem CID 11165538) has the molecular formula C15H13BrFNO4S and a molecular weight of 402.24 g/mol. Its IUPAC name is 7-(3-bromo-4-fluorophenyl)-5-methyl-1,1-dioxo-2,3,4,7-tetrahydrothieno[3,2-b]pyridine-6-carboxylic acid.
| Compound Name | 7-(3-bromo-4-fluorophenyl)-5-methyl-1,1-dioxo-2,3,4,7-tetrahydrothieno[3,2-b]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 11165538 |
| Molecular Formula | C15H13BrFNO4S |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 7-(3-bromo-4-fluorophenyl)-5-methyl-1,1-dioxo-2,3,4,7-tetrahydrothieno[3,2-b]pyridine-6-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2ccc(F)c(Br)c2)C2=C(CCS2(=O)=O)N1 |
| InChI | InChI=1S/C15H13BrFNO4S/c1-7-12(15(19)20)13(8-2-3-10(17)9(16)6-8)14-11(18-7)4-5-23(14,21)22/h2-3,6,13,18H,4-5H2,1H3,(H,19,20) |
| InChIKey | PKFRJISEUHGODA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |