C24H40IN7O — CID 111655847
1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111655847) has the molecular formula C24H40IN7O and a molecular weight of 569.54 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111655847 |
| Molecular Formula | C24H40IN7O |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCCN1CCN(C)CC1c1ccccc1.I |
| InChI | InChI=1S/C24H39N7O.HI/c1-5-25-23(27-19-24(2,32)21-16-28-30(4)17-21)26-12-9-13-31-15-14-29(3)18-22(31)20-10-7-6-8-11-20;/h6-8,10-11,16-17,22,32H,5,9,12-15,18-19H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | FYWPXOUAORMFLB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|