C26H48OSi — CID 11165619
tert-butyl-[[(1S,2S,4S,5S)-4-[2-[(1R)-3-ethyl-1-methylcyclopent-2-en-1-yl]ethyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane (PubChem CID 11165619) has the molecular formula C26H48OSi and a molecular weight of 404.76 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,4S,5S)-4-[2-[(1R)-3-ethyl-1-methylcyclopent-2-en-1-yl]ethyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S,4S,5S)-4-[2-[(1R)-3-ethyl-1-methylcyclopent-2-en-1-yl]ethyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11165619 |
| Molecular Formula | C26H48OSi |
| Molecular Weight | 404.76 g/mol |
| Exact Mass | 404.35 |
| IUPAC Name | tert-butyl-[[(1S,2S,4S,5S)-4-[2-[(1R)-3-ethyl-1-methylcyclopent-2-en-1-yl]ethyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane |
| SMILES | CCC1=C[C@@](C)(CC[C@@]2(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]2C3(C)C)CC1 |
| InChI | InChI=1S/C26H48OSi/c1-11-19-12-13-25(7,17-19)14-15-26(8)18-21(20-16-22(26)24(20,5)6)27-28(9,10)23(2,3)4/h17,20-22H,11-16,18H2,1-10H3/t20-,21+,22-,25-,26+/m1/s1 |
| InChIKey | PLXZQEIUSZXWNQ-ZDLRPUJNSA-N |
| XLogP | 8.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.76 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|