C20H27NO8 — CID 11165743
benzyl (3aR,4R,6aS)-4-[(1R,2S)-3-ethoxy-1,2-dihydroxy-3-oxopropyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 11165743) has the molecular formula C20H27NO8 and a molecular weight of 409.44 g/mol. Its IUPAC name is benzyl (3aR,4R,6aS)-4-[(1R,2S)-3-ethoxy-1,2-dihydroxy-3-oxopropyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | benzyl (3aR,4R,6aS)-4-[(1R,2S)-3-ethoxy-1,2-dihydroxy-3-oxopropyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 11165743 |
| Molecular Formula | C20H27NO8 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | benzyl (3aR,4R,6aS)-4-[(1R,2S)-3-ethoxy-1,2-dihydroxy-3-oxopropyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H27NO8/c1-4-26-18(24)16(23)15(22)14-17-13(28-20(2,3)29-17)10-21(14)19(25)27-11-12-8-6-5-7-9-12/h5-9,13-17,22-23H,4,10-11H2,1-3H3/t13-,14+,15+,16-,17-/m0/s1 |
| InChIKey | WNKGSZMYASMRDI-BIVLZKPYSA-N |
| XLogP | 0.81 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |