About [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate
[3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate (PubChem CID 11165899) has the molecular formula C26H22O5
and a molecular weight of 414.46 g/mol. Its IUPAC name is [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate |
| PubChem CID | 11165899 |
| Molecular Formula | C26H22O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate |
| SMILES | CC(C)(COC(=O)c1ccc2ccccc2c1)CC1=C(O)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C26H22O5/c1-26(2,14-21-22(27)19-9-5-6-10-20(19)23(28)24(21)29)15-31-25(30)18-12-11-16-7-3-4-8-17(16)13-18/h3-13,27H,14-15H2,1-2H3 |
| InChIKey | VQVRPZDGCCSPJW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate?
The IUPAC name of [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate (CID 11165899) is [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate.
What is the SMILES notation for [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate?
The canonical SMILES for [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate is CC(C)(COC(=O)c1ccc2ccccc2c1)CC1=C(O)c2ccccc2C(=O)C1=O.
What is the InChIKey of [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate?
The InChIKey is VQVRPZDGCCSPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O5/c1-26(2,14-21-22(27)19-9-5-6-10-20(19)23(28)24(21)29)15-31-25(30)18-12-11-16-7-3-4-8-17(16)13-18/h3-13,27H,14-15H2,1-2H3.
What are the key properties of [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate?
[3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate has a molecular weight of 414.46 g/mol, XLogP of 5.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl] naphthalene-2-carboxylate is sourced from PubChem (CID 11165899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).