C19H33IN4O — CID 111660160
2,2-dimethyl-N-[2-[[N'-methyl-N-[2-(3-methylphenyl)propyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide (PubChem CID 111660160) has the molecular formula C19H33IN4O and a molecular weight of 460.40 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[[N'-methyl-N-[2-(3-methylphenyl)propyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide.
| Compound Name | 2,2-dimethyl-N-[2-[[N'-methyl-N-[2-(3-methylphenyl)propyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111660160 |
| Molecular Formula | C19H33IN4O |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2,2-dimethyl-N-[2-[[N'-methyl-N-[2-(3-methylphenyl)propyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)NCC(C)c1cccc(C)c1.I |
| InChI | InChI=1S/C19H32N4O.HI/c1-14-8-7-9-16(12-14)15(2)13-23-18(20-6)22-11-10-21-17(24)19(3,4)5;/h7-9,12,15H,10-11,13H2,1-6H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | JLLWSLVJRFCELI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|