About 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid
2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid (PubChem CID 11166017) has the molecular formula C25H22O4S
and a molecular weight of 418.51 g/mol. Its IUPAC name is 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid.
Molecular Properties
| Compound Name | 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid |
| PubChem CID | 11166017 |
| Molecular Formula | C25H22O4S |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c(CSCC(c3ccccc3)c3ccccc3)coc12 |
| InChI | InChI=1S/C25H22O4S/c26-24(27)15-28-23-13-7-12-21-20(14-29-25(21)23)16-30-17-22(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-14,22H,15-17H2,(H,26,27) |
| InChIKey | QAMJPTABDUNWIG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid?
The IUPAC name of 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid (CID 11166017) is 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid.
What is the SMILES notation for 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid?
The canonical SMILES for 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid is O=C(O)COc1cccc2c(CSCC(c3ccccc3)c3ccccc3)coc12.
What is the InChIKey of 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid?
The InChIKey is QAMJPTABDUNWIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O4S/c26-24(27)15-28-23-13-7-12-21-20(14-29-25(21)23)16-30-17-22(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-14,22H,15-17H2,(H,26,27).
What are the key properties of 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid?
2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid has a molecular weight of 418.51 g/mol, XLogP of 5.96, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(2,2-diphenylethylsulfanylmethyl)-1-benzofuran-7-yl]oxy]acetic acid is sourced from PubChem (CID 11166017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).