C21H22ClNO6 — CID 11166046
(2S,3R,4S,5S,6R)-2-[[3-[(4-chlorophenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 11166046) has the molecular formula C21H22ClNO6 and a molecular weight of 419.86 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[[3-[(4-chlorophenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[[3-[(4-chlorophenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11166046 |
| Molecular Formula | C21H22ClNO6 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[[3-[(4-chlorophenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc3[nH]cc(Cc4ccc(Cl)cc4)c23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H22ClNO6/c22-13-6-4-11(5-7-13)8-12-9-23-14-2-1-3-15(17(12)14)28-21-20(27)19(26)18(25)16(10-24)29-21/h1-7,9,16,18-21,23-27H,8,10H2/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | DLVLZNPDTGAHNM-QNDFHXLGSA-N |
| XLogP | 1.59 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |