C19H26N2O3 — CID 111661353
N-[1-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-3-methyl-1-oxobutan-2-yl]-3-methylbenzamide (PubChem CID 111661353) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[1-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-3-methyl-1-oxobutan-2-yl]-3-methylbenzamide.
| Compound Name | N-[1-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-3-methyl-1-oxobutan-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 111661353 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[1-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-3-methyl-1-oxobutan-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(C(=O)N[C@@H]2C=C[C@H](CO)C2)C(C)C)c1 |
| InChI | InChI=1S/C19H26N2O3/c1-12(2)17(19(24)20-16-8-7-14(10-16)11-22)21-18(23)15-6-4-5-13(3)9-15/h4-9,12,14,16-17,22H,10-11H2,1-3H3,(H,20,24)(H,21,23)/t14-,16+,17?/m0/s1 |
| InChIKey | LYUUPVUEJCLNFI-NOYLFRNESA-N |
| XLogP | 1.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|