C16H15FN2O2S — CID 111661369
2-(2-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1,3-thiazole-5-carboxamide (PubChem CID 111661369) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111661369 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1cnc(-c2ccccc2F)s1 |
| InChI | InChI=1S/C16H15FN2O2S/c17-13-4-2-1-3-12(13)16-18-8-14(22-16)15(21)19-11-6-5-10(7-11)9-20/h1-6,8,10-11,20H,7,9H2,(H,19,21)/t10-,11+/m0/s1 |
| InChIKey | JTJSIZAGYAKSTB-WDEREUQCSA-N |
| XLogP | 2.62 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|