C20H27NO2 — CID 111661382
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(4-phenylcyclohexyl)acetamide (PubChem CID 111661382) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(4-phenylcyclohexyl)acetamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(4-phenylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 111661382 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-(4-phenylcyclohexyl)acetamide |
| SMILES | O=C(CC1CCC(c2ccccc2)CC1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C20H27NO2/c22-14-16-8-11-19(12-16)21-20(23)13-15-6-9-18(10-7-15)17-4-2-1-3-5-17/h1-5,8,11,15-16,18-19,22H,6-7,9-10,12-14H2,(H,21,23)/t15?,16-,18?,19+/m0/s1 |
| InChIKey | KZHVHZJKRIVFOA-DHRZBBNESA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|