C18H21N3O2 — CID 111661499
5-ethyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-phenylpyrazole-4-carboxamide (PubChem CID 111661499) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 5-ethyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-ethyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 111661499 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 5-ethyl-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1-phenylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)N[C@@H]2C=C[C@H](CO)C2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C18H21N3O2/c1-2-17-16(11-19-21(17)15-6-4-3-5-7-15)18(23)20-14-9-8-13(10-14)12-22/h3-9,11,13-14,22H,2,10,12H2,1H3,(H,20,23)/t13-,14+/m0/s1 |
| InChIKey | YOCPAQQBYWBBOK-UONOGXRCSA-N |
| XLogP | 2.10 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|