C25H18N2O5 — CID 11166203
13-(1,3-dihydroxypropan-2-yl)-7-hydroxy-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4(9),5,7,11(15),16,18,20,22-decaene-12,14-dione (PubChem CID 11166203) has the molecular formula C25H18N2O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is 13-(1,3-dihydroxypropan-2-yl)-7-hydroxy-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4(9),5,7,11(15),16,18,20,22-decaene-12,14-dione.
| Compound Name | 13-(1,3-dihydroxypropan-2-yl)-7-hydroxy-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4(9),5,7,11(15),16,18,20,22-decaene-12,14-dione |
|---|---|
| PubChem CID | 11166203 |
| Molecular Formula | C25H18N2O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 13-(1,3-dihydroxypropan-2-yl)-7-hydroxy-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4(9),5,7,11(15),16,18,20,22-decaene-12,14-dione |
| SMILES | O=C1c2c(c3c4cc(O)ccc4[nH]c3c3cc4ccccc4cc23)C(=O)N1C(CO)CO |
| InChI | InChI=1S/C25H18N2O5/c28-10-14(11-29)27-24(31)21-16-7-12-3-1-2-4-13(12)8-17(16)23-20(22(21)25(27)32)18-9-15(30)5-6-19(18)26-23/h1-9,14,26,28-30H,10-11H2 |
| InChIKey | QGWMGHDTNQQMKH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|