C24H29NO6 — CID 11166239
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-propylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol (PubChem CID 11166239) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-propylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-propylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11166239 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-propylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol |
| SMILES | CCCc1ccc(Cc2c[nH]c3cccc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c23)cc1 |
| InChI | InChI=1S/C24H29NO6/c1-2-4-14-7-9-15(10-8-14)11-16-12-25-17-5-3-6-18(20(16)17)30-24-23(29)22(28)21(27)19(13-26)31-24/h3,5-10,12,19,21-29H,2,4,11,13H2,1H3/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | QHDBLNJCQRQDEV-PFKOEMKTSA-N |
| XLogP | 1.89 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |