C17H23NO3 — CID 111662507
N-[2-(2-hydroxyethyl)-4-methylpentyl]-1-benzofuran-2-carboxamide (PubChem CID 111662507) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is N-[2-(2-hydroxyethyl)-4-methylpentyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(2-hydroxyethyl)-4-methylpentyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111662507 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[2-(2-hydroxyethyl)-4-methylpentyl]-1-benzofuran-2-carboxamide |
| SMILES | CC(C)CC(CCO)CNC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H23NO3/c1-12(2)9-13(7-8-19)11-18-17(20)16-10-14-5-3-4-6-15(14)21-16/h3-6,10,12-13,19H,7-9,11H2,1-2H3,(H,18,20) |
| InChIKey | OUJQWFHKJVVXAZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |