C17H27N3OS — CID 111664962
1-ethyl-2-(3-hydroxy-3-phenylpropyl)-3-(2-prop-2-enylsulfanylethyl)guanidine (PubChem CID 111664962) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 1-ethyl-2-(3-hydroxy-3-phenylpropyl)-3-(2-prop-2-enylsulfanylethyl)guanidine.
| Compound Name | 1-ethyl-2-(3-hydroxy-3-phenylpropyl)-3-(2-prop-2-enylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111664962 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-ethyl-2-(3-hydroxy-3-phenylpropyl)-3-(2-prop-2-enylsulfanylethyl)guanidine |
| SMILES | C=CCSCCN/C(=N/CCC(O)c1ccccc1)NCC |
| InChI | InChI=1S/C17H27N3OS/c1-3-13-22-14-12-20-17(18-4-2)19-11-10-16(21)15-8-6-5-7-9-15/h3,5-9,16,21H,1,4,10-14H2,2H3,(H2,18,19,20) |
| InChIKey | KYOSTYLMMVRTQV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|