C23H31N7O2 — CID 11166502
6-(3,5-dimethoxyphenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine (PubChem CID 11166502) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 6-(3,5-dimethoxyphenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine.
| Compound Name | 6-(3,5-dimethoxyphenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 11166502 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 6-(3,5-dimethoxyphenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(NCCCN4CCN(C)CC4)nc3nc2N)c1 |
| InChI | InChI=1S/C23H31N7O2/c1-29-7-9-30(10-8-29)6-4-5-25-23-26-15-17-13-20(21(24)27-22(17)28-23)16-11-18(31-2)14-19(12-16)32-3/h11-15H,4-10H2,1-3H3,(H3,24,25,26,27,28) |
| InChIKey | UECNBLHOZAESMM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|