C26H47NO4 — CID 11166505
tert-butyl (4aR,6S,8aS)-6-[(E)-dodec-1-enyl]-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate (PubChem CID 11166505) has the molecular formula C26H47NO4 and a molecular weight of 437.67 g/mol. Its IUPAC name is tert-butyl (4aR,6S,8aS)-6-[(E)-dodec-1-enyl]-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate.
| Compound Name | tert-butyl (4aR,6S,8aS)-6-[(E)-dodec-1-enyl]-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 11166505 |
| Molecular Formula | C26H47NO4 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.35 |
| IUPAC Name | tert-butyl (4aR,6S,8aS)-6-[(E)-dodec-1-enyl]-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
| SMILES | CCCCCCCCCC/C=C/[C@@H]1CC[C@@H]2OC(C)(C)OC[C@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H47NO4/c1-7-8-9-10-11-12-13-14-15-16-17-21-18-19-23-22(20-29-26(5,6)30-23)27(21)24(28)31-25(2,3)4/h16-17,21-23H,7-15,18-20H2,1-6H3/b17-16+/t21-,22-,23+/m1/s1 |
| InChIKey | OZDLMLVRYCBQLO-VQMSTHNPSA-N |
| XLogP | 6.99 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|