C21H30IN3O — CID 111665669
2-[(2,4-dimethylphenyl)methyl]-1-ethyl-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111665669) has the molecular formula C21H30IN3O and a molecular weight of 467.40 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)methyl]-1-ethyl-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(2,4-dimethylphenyl)methyl]-1-ethyl-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111665669 |
| Molecular Formula | C21H30IN3O |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)methyl]-1-ethyl-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1C)NCCC(O)c1ccccc1.I |
| InChI | InChI=1S/C21H29N3O.HI/c1-4-22-21(24-15-19-11-10-16(2)14-17(19)3)23-13-12-20(25)18-8-6-5-7-9-18;/h5-11,14,20,25H,4,12-13,15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | GKSDADIYGJCRSD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|