C21H16N2O2S — CID 1116657
methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 1116657) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 1116657 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1sc2nc(-c3ccccc3)cc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C21H16N2O2S/c1-25-21(24)19-18(22)17-15(13-8-4-2-5-9-13)12-16(23-20(17)26-19)14-10-6-3-7-11-14/h2-12H,22H2,1H3 |
| InChIKey | WGNJNNSPWUYDJM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |