methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate

C21H16N2O2S — CID 1116657

IUPACmethyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate
SMILESCOC(=O)c1sc2nc(-c3ccccc3)cc(-c3ccccc3)c2c1N
InChIInChI=1S/C21H16N2O2S/c1-25-21(24)19-18(22)17-15(13-8-4-2-5-9-13)12-16(23-20(17)26-19)14-10-6-3-7-11-14/h2-12H,22H2,1H3
InChIKeyWGNJNNSPWUYDJM-UHFFFAOYSA-N
MW360.44 g/mol
LogP5.00
Rot. Bonds3

About methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate

methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 1116657) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate
PubChem CID1116657
Molecular FormulaC21H16N2O2S
Molecular Weight360.44 g/mol
Exact Mass360.09
IUPAC Namemethyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate
SMILESCOC(=O)c1sc2nc(-c3ccccc3)cc(-c3ccccc3)c2c1N
InChIInChI=1S/C21H16N2O2S/c1-25-21(24)19-18(22)17-15(13-8-4-2-5-9-13)12-16(23-20(17)26-19)14-10-6-3-7-11-14/h2-12H,22H2,1H3
InChIKeyWGNJNNSPWUYDJM-UHFFFAOYSA-N
XLogP5.00
TPSA65.21 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.44
LogP ≤ 55.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate?
The IUPAC name of methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate (CID 1116657) is methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate.
What is the SMILES notation for methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate?
The canonical SMILES for methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate is COC(=O)c1sc2nc(-c3ccccc3)cc(-c3ccccc3)c2c1N.
What is the InChIKey of methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate?
The InChIKey is WGNJNNSPWUYDJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O2S/c1-25-21(24)19-18(22)17-15(13-8-4-2-5-9-13)12-16(23-20(17)26-19)14-10-6-3-7-11-14/h2-12H,22H2,1H3.
What are the key properties of methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate?
methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate has a molecular weight of 360.44 g/mol, XLogP of 5.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylate is sourced from PubChem (CID 1116657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).