C21H29BrO3S — CID 11166598
[(2S)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 4-methylbenzenesulfonate (PubChem CID 11166598) has the molecular formula C21H29BrO3S and a molecular weight of 441.43 g/mol. Its IUPAC name is [(2S)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11166598 |
| Molecular Formula | C21H29BrO3S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [(2S)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](C)[C@H]2CC[C@H]3/C(=C/Br)CCC[C@]23C)cc1 |
| InChI | InChI=1S/C21H29BrO3S/c1-15-6-8-18(9-7-15)26(23,24)25-14-16(2)19-10-11-20-17(13-22)5-4-12-21(19,20)3/h6-9,13,16,19-20H,4-5,10-12,14H2,1-3H3/b17-13+/t16-,19-,20+,21-/m1/s1 |
| InChIKey | AZALKEGVNDVWOI-LGGVZGNTSA-N |
| XLogP | 5.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|