C24H24N6O3 — CID 11166690
(2R,3R,4S,5R)-2-[8-anilino-6-(2,3-dihydroindol-1-yl)purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 11166690) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[8-anilino-6-(2,3-dihydroindol-1-yl)purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[8-anilino-6-(2,3-dihydroindol-1-yl)purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 11166690 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-[8-anilino-6-(2,3-dihydroindol-1-yl)purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2c(Nc3ccccc3)nc3c(N4CCc5ccccc54)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H24N6O3/c1-14-19(31)20(32)23(33-14)30-22-18(28-24(30)27-16-8-3-2-4-9-16)21(25-13-26-22)29-12-11-15-7-5-6-10-17(15)29/h2-10,13-14,19-20,23,31-32H,11-12H2,1H3,(H,27,28)/t14-,19-,20-,23-/m1/s1 |
| InChIKey | LXCXBRDVOKYSOA-DVHMWJAFSA-N |
| XLogP | 2.90 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |