C22H34N6O4 — CID 11166752
2,6-bis(2-methoxyethoxy)-4,8-di(piperidin-1-yl)pyrimido[5,4-d]pyrimidine (PubChem CID 11166752) has the molecular formula C22H34N6O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 2,6-bis(2-methoxyethoxy)-4,8-di(piperidin-1-yl)pyrimido[5,4-d]pyrimidine.
| Compound Name | 2,6-bis(2-methoxyethoxy)-4,8-di(piperidin-1-yl)pyrimido[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 11166752 |
| Molecular Formula | C22H34N6O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 2,6-bis(2-methoxyethoxy)-4,8-di(piperidin-1-yl)pyrimido[5,4-d]pyrimidine |
| SMILES | COCCOc1nc(N2CCCCC2)c2nc(OCCOC)nc(N3CCCCC3)c2n1 |
| InChI | InChI=1S/C22H34N6O4/c1-29-13-15-31-21-23-17-18(19(25-21)27-9-5-3-6-10-27)24-22(32-16-14-30-2)26-20(17)28-11-7-4-8-12-28/h3-16H2,1-2H3 |
| InChIKey | PCMFSEDQAIFBEV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 94.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|