C23H40IN5O — CID 111668019
3-[2-[[N'-[2-[cyclohexyl(methyl)amino]ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111668019) has the molecular formula C23H40IN5O and a molecular weight of 529.51 g/mol. Its IUPAC name is 3-[2-[[N'-[2-[cyclohexyl(methyl)amino]ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N'-[2-[cyclohexyl(methyl)amino]ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111668019 |
| Molecular Formula | C23H40IN5O |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 3-[2-[[N'-[2-[cyclohexyl(methyl)amino]ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)C1CCCCC1)NCCc1cccc(C(=O)N(C)C)c1.I |
| InChI | InChI=1S/C23H39N5O.HI/c1-5-24-23(26-16-17-28(4)21-12-7-6-8-13-21)25-15-14-19-10-9-11-20(18-19)22(29)27(2)3;/h9-11,18,21H,5-8,12-17H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | BTEDWOBWDHBTNC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|