C23H26F3N3O — CID 11166919
10-methyl-2-[2-methyl-4-(trifluoromethoxy)phenyl]-7-pentan-3-yl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene (PubChem CID 11166919) has the molecular formula C23H26F3N3O and a molecular weight of 417.48 g/mol. Its IUPAC name is 10-methyl-2-[2-methyl-4-(trifluoromethoxy)phenyl]-7-pentan-3-yl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene.
| Compound Name | 10-methyl-2-[2-methyl-4-(trifluoromethoxy)phenyl]-7-pentan-3-yl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene |
|---|---|
| PubChem CID | 11166919 |
| Molecular Formula | C23H26F3N3O |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 10-methyl-2-[2-methyl-4-(trifluoromethoxy)phenyl]-7-pentan-3-yl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene |
| SMILES | CCC(CC)N1CCc2cn(-c3ccc(OC(F)(F)F)cc3C)c3nc(C)cc1c23 |
| InChI | InChI=1S/C23H26F3N3O/c1-5-17(6-2)28-10-9-16-13-29(22-21(16)20(28)12-15(4)27-22)19-8-7-18(11-14(19)3)30-23(24,25)26/h7-8,11-13,17H,5-6,9-10H2,1-4H3 |
| InChIKey | BFFQAWDYQOJUFZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |